C21H27N2O3+ — CID 7455616
(3R)-1-benzyl-3-[(1R)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]pyrrolidine-2,5-dione (PubChem CID 7455616) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[(1R)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-benzyl-3-[(1R)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7455616 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (3R)-1-benzyl-3-[(1R)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([C@H]2CCCC=C2[NH+]2CCOCC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2O3/c24-20-14-18(21(25)23(20)15-16-6-2-1-3-7-16)17-8-4-5-9-19(17)22-10-12-26-13-11-22/h1-3,6-7,9,17-18H,4-5,8,10-15H2/p+1/t17-,18-/m1/s1 |
| InChIKey | UXOMCKBUZWTLOF-QZTJIDSGSA-O |
| XLogP | 1.16 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|