C21H24F3N2O3+ — CID 7455700
(3R)-3-[(1S)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione (PubChem CID 7455700) has the molecular formula C21H24F3N2O3+ and a molecular weight of 409.43 g/mol. Its IUPAC name is (3R)-3-[(1S)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(1S)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7455700 |
| Molecular Formula | C21H24F3N2O3+ |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (3R)-3-[(1S)-2-morpholin-4-ium-4-ylcyclohex-2-en-1-yl]-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([C@@H]2CCCC=C2[NH+]2CCOCC2)C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3N2O3/c22-21(23,24)14-4-3-5-15(12-14)26-19(27)13-17(20(26)28)16-6-1-2-7-18(16)25-8-10-29-11-9-25/h3-5,7,12,16-17H,1-2,6,8-11,13H2/p+1/t16-,17+/m0/s1 |
| InChIKey | KOJFHACVEAYTSQ-DLBZAZTESA-O |
| XLogP | 2.18 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|