C28H29FN4O2 — CID 4882223
5,5-dibenzyl-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 4882223) has the molecular formula C28H29FN4O2 and a molecular weight of 472.56 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4882223 |
| Molecular Formula | C28H29FN4O2 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 5,5-dibenzyl-3-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)(Cc2ccccc2)C(=O)N1CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C28H29FN4O2/c29-24-13-7-8-14-25(24)32-17-15-31(16-18-32)21-33-26(34)28(30-27(33)35,19-22-9-3-1-4-10-22)20-23-11-5-2-6-12-23/h1-14H,15-21H2,(H,30,35) |
| InChIKey | LWYPTLPVWSXUGA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|