C27H35FN4O2 — CID 90654844
3-benzyl-1-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 90654844) has the molecular formula C27H35FN4O2 and a molecular weight of 466.60 g/mol. Its IUPAC name is 3-benzyl-1-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-benzyl-1-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90654844 |
| Molecular Formula | C27H35FN4O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 3-benzyl-1-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(Cc2ccccc2)C(=O)N1CCCCCN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C27H35FN4O2/c1-27(2)25(33)31(21-22-11-5-3-6-12-22)26(34)32(27)16-10-4-9-15-29-17-19-30(20-18-29)24-14-8-7-13-23(24)28/h3,5-8,11-14H,4,9-10,15-21H2,1-2H3 |
| InChIKey | XIGANRPOOMJWDJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|