C25H23FN2O3 — CID 17394454
5,5-dibenzyl-3-[2-(2-fluorophenoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 17394454) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is 5,5-dibenzyl-3-[2-(2-fluorophenoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dibenzyl-3-[2-(2-fluorophenoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17394454 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 5,5-dibenzyl-3-[2-(2-fluorophenoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)(Cc2ccccc2)C(=O)N1CCOc1ccccc1F |
| InChI | InChI=1S/C25H23FN2O3/c26-21-13-7-8-14-22(21)31-16-15-28-23(29)25(27-24(28)30,17-19-9-3-1-4-10-19)18-20-11-5-2-6-12-20/h1-14H,15-18H2,(H,27,30) |
| InChIKey | GWDCFYNIUHSIBJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|