C14H16N2O5 — CID 43243887
2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethoxy]benzoic acid (PubChem CID 43243887) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethoxy]benzoic acid.
| Compound Name | 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 43243887 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethoxy]benzoic acid |
| SMILES | CC1(C)NC(=O)N(CCOc2ccccc2C(=O)O)C1=O |
| InChI | InChI=1S/C14H16N2O5/c1-14(2)12(19)16(13(20)15-14)7-8-21-10-6-4-3-5-9(10)11(17)18/h3-6H,7-8H2,1-2H3,(H,15,20)(H,17,18) |
| InChIKey | JDBUPWWVFBYKJZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|