C14H19N3O3 — CID 43365746
3-[3-(2-aminophenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 43365746) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[3-(2-aminophenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(2-aminophenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 43365746 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[3-(2-aminophenoxy)propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(CCCOc2ccccc2N)C1=O |
| InChI | InChI=1S/C14H19N3O3/c1-14(2)12(18)17(13(19)16-14)8-5-9-20-11-7-4-3-6-10(11)15/h3-4,6-7H,5,8-9,15H2,1-2H3,(H,16,19) |
| InChIKey | LQDFZHXXXJWMOC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|