C18H27N3O3 — CID 94184517
3-[3-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 94184517) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[3-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94184517 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[3-[[(1S)-1-(2-methoxyphenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1ccccc1[C@H](C)N(C)CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C18H27N3O3/c1-13(14-9-6-7-10-15(14)24-5)20(4)11-8-12-21-16(22)18(2,3)19-17(21)23/h6-7,9-10,13H,8,11-12H2,1-5H3,(H,19,23)/t13-/m0/s1 |
| InChIKey | ZHJGLLUBFFOTTP-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|