C17H24FN3O2 — CID 94470068
3-[3-[[(1S)-1-(2-fluorophenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 94470068) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[3-[[(1S)-1-(2-fluorophenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[[(1S)-1-(2-fluorophenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94470068 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[3-[[(1S)-1-(2-fluorophenyl)ethyl]-methylamino]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | C[C@@H](c1ccccc1F)N(C)CCCN1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C17H24FN3O2/c1-12(13-8-5-6-9-14(13)18)20(4)10-7-11-21-15(22)17(2,3)19-16(21)23/h5-6,8-9,12H,7,10-11H2,1-4H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | BDSFULHPCHGXBM-LBPRGKRZSA-N |
| XLogP | 2.54 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|