C17H25N3O4S — CID 131960941
N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-N,3,4-trimethylbenzenesulfonamide (PubChem CID 131960941) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-N,3,4-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-N,3,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 131960941 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propyl]-N,3,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCCN2C(=O)NC(C)(C)C2=O)cc1C |
| InChI | InChI=1S/C17H25N3O4S/c1-12-7-8-14(11-13(12)2)25(23,24)19(5)9-6-10-20-15(21)17(3,4)18-16(20)22/h7-8,11H,6,9-10H2,1-5H3,(H,18,22) |
| InChIKey | MONSTNBUYTYRAV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|