C11H20ClN3O4 — CID 119912786
2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-methylamino]propanoic acid;hydrochloride (PubChem CID 119912786) has the molecular formula C11H20ClN3O4 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-methylamino]propanoic acid;hydrochloride.
| Compound Name | 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119912786 |
| Molecular Formula | C11H20ClN3O4 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl-methylamino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CCN1C(=O)NC(C)(C)C1=O.Cl |
| InChI | InChI=1S/C11H19N3O4.ClH/c1-7(8(15)16)13(4)5-6-14-9(17)11(2,3)12-10(14)18;/h7H,5-6H2,1-4H3,(H,12,18)(H,15,16);1H |
| InChIKey | CVOJJJLGUAGSGT-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|