C12H23N3O3 — CID 113236564
3-[2-[(2-hydroxy-2-methylpropyl)-methylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 113236564) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-[2-[(2-hydroxy-2-methylpropyl)-methylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[(2-hydroxy-2-methylpropyl)-methylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 113236564 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 3-[2-[(2-hydroxy-2-methylpropyl)-methylamino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN(CCN1C(=O)NC(C)(C)C1=O)CC(C)(C)O |
| InChI | InChI=1S/C12H23N3O3/c1-11(2,18)8-14(5)6-7-15-9(16)12(3,4)13-10(15)17/h18H,6-8H2,1-5H3,(H,13,17) |
| InChIKey | IQQBABMMYWCSGL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|