C15H27N3O2 — CID 34195722
3-[2-[cycloheptyl(methyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 34195722) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[2-[cycloheptyl(methyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[cycloheptyl(methyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 34195722 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 3-[2-[cycloheptyl(methyl)amino]ethyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN(CCN1C(=O)NC(C)(C)C1=O)C1CCCCCC1 |
| InChI | InChI=1S/C15H27N3O2/c1-15(2)13(19)18(14(20)16-15)11-10-17(3)12-8-6-4-5-7-9-12/h12H,4-11H2,1-3H3,(H,16,20) |
| InChIKey | ZKCWDDNBKSAOCJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|