C14H23NO2 — CID 51081765
3-methoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylpropan-1-amine (PubChem CID 51081765) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 3-methoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylpropan-1-amine.
| Compound Name | 3-methoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 51081765 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 3-methoxy-N-[1-(2-methoxyphenyl)ethyl]-N-methylpropan-1-amine |
| SMILES | COCCCN(C)C(C)c1ccccc1OC |
| InChI | InChI=1S/C14H23NO2/c1-12(15(2)10-7-11-16-3)13-8-5-6-9-14(13)17-4/h5-6,8-9,12H,7,10-11H2,1-4H3 |
| InChIKey | WNGOVLUBOPIUMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|