C20H29ClN2O3 — CID 2215988
3-[4-[2-chloro-4-(2-methylbutan-2-yl)phenoxy]butyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 2215988) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 3-[4-[2-chloro-4-(2-methylbutan-2-yl)phenoxy]butyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[2-chloro-4-(2-methylbutan-2-yl)phenoxy]butyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2215988 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 3-[4-[2-chloro-4-(2-methylbutan-2-yl)phenoxy]butyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCC(C)(C)c1ccc(OCCCCN2C(=O)NC(C)(C)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C20H29ClN2O3/c1-6-19(2,3)14-9-10-16(15(21)13-14)26-12-8-7-11-23-17(24)20(4,5)22-18(23)25/h9-10,13H,6-8,11-12H2,1-5H3,(H,22,25) |
| InChIKey | NTGPIDZHGRSUQA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|