C15H17FN2O3 — CID 4881528
5-cyclopropyl-3-[2-(2-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 4881528) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 5-cyclopropyl-3-[2-(2-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-cyclopropyl-3-[2-(2-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4881528 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-cyclopropyl-3-[2-(2-fluorophenoxy)ethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(C2CC2)NC(=O)N(CCOc2ccccc2F)C1=O |
| InChI | InChI=1S/C15H17FN2O3/c1-15(10-6-7-10)13(19)18(14(20)17-15)8-9-21-12-5-3-2-4-11(12)16/h2-5,10H,6-9H2,1H3,(H,17,20) |
| InChIKey | LQBUEYXCWOMLTG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|