C17H18F2N2O2 — CID 97339255
(5R)-5-cyclopropyl-3-[[1-(2,6-difluorophenyl)cyclopropyl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 97339255) has the molecular formula C17H18F2N2O2 and a molecular weight of 320.34 g/mol. Its IUPAC name is (5R)-5-cyclopropyl-3-[[1-(2,6-difluorophenyl)cyclopropyl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-cyclopropyl-3-[[1-(2,6-difluorophenyl)cyclopropyl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97339255 |
| Molecular Formula | C17H18F2N2O2 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (5R)-5-cyclopropyl-3-[[1-(2,6-difluorophenyl)cyclopropyl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(C2CC2)NC(=O)N(CC2(c3c(F)cccc3F)CC2)C1=O |
| InChI | InChI=1S/C17H18F2N2O2/c1-16(10-5-6-10)14(22)21(15(23)20-16)9-17(7-8-17)13-11(18)3-2-4-12(13)19/h2-4,10H,5-9H2,1H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | QPDJVRBMEGLTAI-MRXNPFEDSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|