C21H23FN2O3 — CID 46815465
3-[2-(2-fluorophenoxy)ethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione (PubChem CID 46815465) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[2-(2-fluorophenoxy)ethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-fluorophenoxy)ethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46815465 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-[2-(2-fluorophenoxy)ethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CCOc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C21H23FN2O3/c1-3-6-15-9-11-16(12-10-15)21(2)19(25)24(20(26)23-21)13-14-27-18-8-5-4-7-17(18)22/h4-5,7-12H,3,6,13-14H2,1-2H3,(H,23,26) |
| InChIKey | UALMLRCXNFUMQT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|