C19H26N2O4 — CID 56556505
ethyl 4-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]butanoate (PubChem CID 56556505) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 4-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 56556505 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | ethyl 4-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]butanoate |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CCCC(=O)OCC)C2=O)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-4-7-14-9-11-15(12-10-14)19(3)17(23)21(18(24)20-19)13-6-8-16(22)25-5-2/h9-12H,4-8,13H2,1-3H3,(H,20,24) |
| InChIKey | GYNBJFPDQOYQSD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|