C21H23N3O3 — CID 17467243
2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-phenylacetamide (PubChem CID 17467243) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 17467243 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-phenylacetamide |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-3-7-15-10-12-16(13-11-15)21(2)19(26)24(20(27)23-21)14-18(25)22-17-8-5-4-6-9-17/h4-6,8-13H,3,7,14H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | WYBRYWOKFASPAY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|