C26H32N4O4 — CID 24630086
2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide (PubChem CID 24630086) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24630086 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccc(CN4CCOCC4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H32N4O4/c1-3-4-19-5-9-21(10-6-19)26(2)24(32)30(25(33)28-26)18-23(31)27-22-11-7-20(8-12-22)17-29-13-15-34-16-14-29/h5-12H,3-4,13-18H2,1-2H3,(H,27,31)(H,28,33) |
| InChIKey | APLTXCPGYFQLAE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|