C22H23ClN4O6S — CID 25401326
2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 25401326) has the molecular formula C22H23ClN4O6S and a molecular weight of 506.97 g/mol. Its IUPAC name is 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 25401326 |
| Molecular Formula | C22H23ClN4O6S |
| Molecular Weight | 506.97 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | 2-[(4R)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | C[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C22H23ClN4O6S/c1-22(15-2-4-16(23)5-3-15)20(29)27(21(30)25-22)14-19(28)24-17-6-8-18(9-7-17)34(31,32)26-10-12-33-13-11-26/h2-9H,10-14H2,1H3,(H,24,28)(H,25,30)/t22-/m1/s1 |
| InChIKey | AVVYGKQOJIBMGR-JOCHJYFZSA-N |
| XLogP | 1.77 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.97 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|