C21H30N4O6S — CID 5233496
2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 5233496) has the molecular formula C21H30N4O6S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 5233496 |
| Molecular Formula | C21H30N4O6S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]-N-(4-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | CC(C)CCC1(C)NC(=O)N(CC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)C1=O |
| InChI | InChI=1S/C21H30N4O6S/c1-15(2)8-9-21(3)19(27)25(20(28)23-21)14-18(26)22-16-4-6-17(7-5-16)32(29,30)24-10-12-31-13-11-24/h4-7,15H,8-14H2,1-3H3,(H,22,26)(H,23,28) |
| InChIKey | CQJOHBFQSMQTFR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|