C17H21Cl2N3O3 — CID 4804638
N-(3,5-dichlorophenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4804638) has the molecular formula C17H21Cl2N3O3 and a molecular weight of 386.28 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4804638 |
| Molecular Formula | C17H21Cl2N3O3 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CCC1(C)NC(=O)N(CC(=O)Nc2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C17H21Cl2N3O3/c1-10(2)4-5-17(3)15(24)22(16(25)21-17)9-14(23)20-13-7-11(18)6-12(19)8-13/h6-8,10H,4-5,9H2,1-3H3,(H,20,23)(H,21,25) |
| InChIKey | WRCUQQJTYPHZEI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|