C18H23F2N3O3S — CID 4804611
N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 4804611) has the molecular formula C18H23F2N3O3S and a molecular weight of 399.46 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 4804611 |
| Molecular Formula | C18H23F2N3O3S |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-methyl-4-(3-methylbutyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC(C)CCC1(C)NC(=O)N(CC(=O)Nc2ccc(SC(F)F)cc2)C1=O |
| InChI | InChI=1S/C18H23F2N3O3S/c1-11(2)8-9-18(3)15(25)23(17(26)22-18)10-14(24)21-12-4-6-13(7-5-12)27-16(19)20/h4-7,11,16H,8-10H2,1-3H3,(H,21,24)(H,22,26) |
| InChIKey | RWZAPSDVICRKOC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|