C21H21F2N3O3 — CID 55375107
N-(3,4-difluorophenyl)-2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]acetamide (PubChem CID 55375107) has the molecular formula C21H21F2N3O3 and a molecular weight of 401.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55375107 |
| Molecular Formula | C21H21F2N3O3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[4-methyl-2,5-dioxo-4-(4-propylphenyl)imidazolidin-1-yl]acetamide |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CC(=O)Nc3ccc(F)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C21H21F2N3O3/c1-3-4-13-5-7-14(8-6-13)21(2)19(28)26(20(29)25-21)12-18(27)24-15-9-10-16(22)17(23)11-15/h5-11H,3-4,12H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | RFFYXTQDRJEVSI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|