C23H24F2N4O4 — CID 46646653
4-[[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N,N-diethylbenzamide (PubChem CID 46646653) has the molecular formula C23H24F2N4O4 and a molecular weight of 458.47 g/mol. Its IUPAC name is 4-[[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 46646653 |
| Molecular Formula | C23H24F2N4O4 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 4-[[2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)CN2C(=O)NC(C)(c3ccc(F)c(F)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H24F2N4O4/c1-4-28(5-2)20(31)14-6-9-16(10-7-14)26-19(30)13-29-21(32)23(3,27-22(29)33)15-8-11-17(24)18(25)12-15/h6-12H,4-5,13H2,1-3H3,(H,26,30)(H,27,33) |
| InChIKey | QVFCFOQSQWITAF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|