C17H13ClF2N4O3 — CID 51935140
N-(5-chloro-2-pyridinyl)-2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 51935140) has the molecular formula C17H13ClF2N4O3 and a molecular weight of 394.77 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 51935140 |
| Molecular Formula | C17H13ClF2N4O3 |
| Molecular Weight | 394.77 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccc(F)c(F)c2)NC(=O)N(CC(=O)Nc2ccc(Cl)cn2)C1=O |
| InChI | InChI=1S/C17H13ClF2N4O3/c1-17(9-2-4-11(19)12(20)6-9)15(26)24(16(27)23-17)8-14(25)22-13-5-3-10(18)7-21-13/h2-7H,8H2,1H3,(H,23,27)(H,21,22,25)/t17-/m1/s1 |
| InChIKey | VMMUFBWBWNQDBD-QGZVFWFLSA-N |
| XLogP | 2.42 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|