C12H10ClFN2O4 — CID 93239430
2-[(4S)-4-(3-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 93239430) has the molecular formula C12H10ClFN2O4 and a molecular weight of 300.67 g/mol. Its IUPAC name is 2-[(4S)-4-(3-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4S)-4-(3-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 93239430 |
| Molecular Formula | C12H10ClFN2O4 |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 2-[(4S)-4-(3-chloro-4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | C[C@@]1(c2ccc(F)c(Cl)c2)NC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C12H10ClFN2O4/c1-12(6-2-3-8(14)7(13)4-6)10(19)16(5-9(17)18)11(20)15-12/h2-4H,5H2,1H3,(H,15,20)(H,17,18)/t12-/m0/s1 |
| InChIKey | KIJHCCWQWZTUBS-LBPRGKRZSA-N |
| XLogP | 1.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|