C19H25F2N3O3 — CID 24520507
2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-methylhexan-2-yl)acetamide (PubChem CID 24520507) has the molecular formula C19H25F2N3O3 and a molecular weight of 381.42 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-methylhexan-2-yl)acetamide.
| Compound Name | 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-methylhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 24520507 |
| Molecular Formula | C19H25F2N3O3 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(5-methylhexan-2-yl)acetamide |
| SMILES | CC(C)CCC(C)NC(=O)CN1C(=O)NC(C)(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C19H25F2N3O3/c1-11(2)5-6-12(3)22-16(25)10-24-17(26)19(4,23-18(24)27)13-7-8-14(20)15(21)9-13/h7-9,11-12H,5-6,10H2,1-4H3,(H,22,25)(H,23,27) |
| InChIKey | VFTREFJCTKHDRA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|