C17H22ClN3O3 — CID 2705958
2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide (PubChem CID 2705958) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide.
| Compound Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 2705958 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[(4S)-4-(4-chlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C17H22ClN3O3/c1-4-13(5-2)19-14(22)10-21-15(23)17(3,20-16(21)24)11-6-8-12(18)9-7-11/h6-9,13H,4-5,10H2,1-3H3,(H,19,22)(H,20,24)/t17-/m0/s1 |
| InChIKey | YRRYIHBFFTUPJJ-KRWDZBQOSA-N |
| XLogP | 2.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|