C16H19F2N3O3 — CID 41075308
2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide (PubChem CID 41075308) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 41075308 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[(4R)-4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1C(=O)N[C@](C)(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C16H19F2N3O3/c1-4-20(5-2)13(22)9-21-14(23)16(3,19-15(21)24)10-6-7-11(17)12(18)8-10/h6-8H,4-5,9H2,1-3H3,(H,19,24)/t16-/m1/s1 |
| InChIKey | UNAIXKPPZYALDU-MRXNPFEDSA-N |
| XLogP | 1.60 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|