C24H30N3O4+ — CID 7911332
(5S)-3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione (PubChem CID 7911332) has the molecular formula C24H30N3O4+ and a molecular weight of 424.52 g/mol. Its IUPAC name is (5S)-3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7911332 |
| Molecular Formula | C24H30N3O4+ |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (5S)-3-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-5-methyl-5-(2-phenylethyl)imidazolidine-2,4-dione |
| SMILES | COc1cc2c(cc1OC)C[NH+](CN1C(=O)N[C@@](C)(CCc3ccccc3)C1=O)CC2 |
| InChI | InChI=1S/C24H29N3O4/c1-24(11-9-17-7-5-4-6-8-17)22(28)27(23(29)25-24)16-26-12-10-18-13-20(30-2)21(31-3)14-19(18)15-26/h4-8,13-14H,9-12,15-16H2,1-3H3,(H,25,29)/p+1/t24-/m0/s1 |
| InChIKey | HKLQUYYULXDUFB-DEOSSOPVSA-O |
| XLogP | 1.55 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|