C20H27N2O4+ — CID 9206482
2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 9206482) has the molecular formula C20H27N2O4+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 9206482 |
| Molecular Formula | C20H27N2O4+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)methyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C[NH+](CN1C(=O)CC3(CCCC3)C1=O)CC2 |
| InChI | InChI=1S/C20H26N2O4/c1-25-16-9-14-5-8-21(12-15(14)10-17(16)26-2)13-22-18(23)11-20(19(22)24)6-3-4-7-20/h9-10H,3-8,11-13H2,1-2H3/p+1 |
| InChIKey | QYSIYNIIUJUNGB-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|