C22H32FN3O3+2 — CID 9285187
2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 9285187) has the molecular formula C22H32FN3O3+2 and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 9285187 |
| Molecular Formula | C22H32FN3O3+2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 2-[[4-[(3-fluoro-4-methoxyphenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | COc1ccc(C[NH+]2CC[NH+](CN3C(=O)CC4(CCCCC4)C3=O)CC2)cc1F |
| InChI | InChI=1S/C22H30FN3O3/c1-29-19-6-5-17(13-18(19)23)15-24-9-11-25(12-10-24)16-26-20(27)14-22(21(26)28)7-3-2-4-8-22/h5-6,13H,2-4,7-12,14-16H2,1H3/p+2 |
| InChIKey | OHRXAPMRQMSYPF-UHFFFAOYSA-P |
| XLogP | -0.22 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|