C21H31N2O4+ — CID 9235710
(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium (PubChem CID 9235710) has the molecular formula C21H31N2O4+ and a molecular weight of 375.49 g/mol. Its IUPAC name is (1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | (1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9235710 |
| Molecular Formula | C21H31N2O4+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (1,3-dioxo-2-azaspiro[4.5]decan-2-yl)methyl-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CN2C(=O)CC3(CCCCC3)C2=O)cc1OC |
| InChI | InChI=1S/C21H30N2O4/c1-4-27-17-9-8-16(12-18(17)26-3)14-22(2)15-23-19(24)13-21(20(23)25)10-6-5-7-11-21/h8-9,12H,4-7,10-11,13-15H2,1-3H3/p+1 |
| InChIKey | WBMYRYNKQJAJSQ-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|