C18H25BrN3O3+ — CID 2575587
(5-bromo-2-methoxyphenyl)methyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium (PubChem CID 2575587) has the molecular formula C18H25BrN3O3+ and a molecular weight of 411.32 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 2575587 |
| Molecular Formula | C18H25BrN3O3+ |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C18H24BrN3O3/c1-21(11-13-10-14(19)6-7-15(13)25-2)12-22-16(23)18(20-17(22)24)8-4-3-5-9-18/h6-7,10H,3-5,8-9,11-12H2,1-2H3,(H,20,24)/p+1 |
| InChIKey | YAVJWERPUQMFLB-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|