C22H25N2O4+ — CID 6978163
2-[(2R)-1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-yl]isoindole-1,3-dione (PubChem CID 6978163) has the molecular formula C22H25N2O4+ and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[(2R)-1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6978163 |
| Molecular Formula | C22H25N2O4+ |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[(2R)-1-(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propan-2-yl]isoindole-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C[NH+](C[C@@H](C)N1C(=O)c3ccccc3C1=O)CC2 |
| InChI | InChI=1S/C22H24N2O4/c1-14(24-21(25)17-6-4-5-7-18(17)22(24)26)12-23-9-8-15-10-19(27-2)20(28-3)11-16(15)13-23/h4-7,10-11,14H,8-9,12-13H2,1-3H3/p+1/t14-/m1/s1 |
| InChIKey | WQMSBOMDUUDBEU-CQSZACIVSA-O |
| XLogP | 1.33 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|