C22H31N3O4 — CID 9171344
(3aR,7aR)-2-[[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 9171344) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 9171344 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (3aR,7aR)-2-[[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | COc1ccc(OCCN2CCN(CN3C(=O)[C@@H]4CCCC[C@H]4C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O4/c1-28-17-6-8-18(9-7-17)29-15-14-23-10-12-24(13-11-23)16-25-21(26)19-4-2-3-5-20(19)22(25)27/h6-9,19-20H,2-5,10-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | HDTRNDIZNZTGBA-WOJBJXKFSA-N |
| XLogP | 1.82 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|