C22H33N3O4 — CID 7117211
(3R)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-1-(3-methylbutyl)pyrrolidine-2,5-dione (PubChem CID 7117211) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (3R)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-1-(3-methylbutyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-1-(3-methylbutyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7117211 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3R)-3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-1-yl]-1-(3-methylbutyl)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(OCCN2CCN([C@@H]3CC(=O)N(CCC(C)C)C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H33N3O4/c1-17(2)8-9-25-21(26)16-20(22(25)27)24-12-10-23(11-13-24)14-15-29-19-6-4-18(28-3)5-7-19/h4-7,17,20H,8-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | DYKLDLFQOHIPEA-HXUWFJFHSA-N |
| XLogP | 1.87 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|