C18H22N3O2S+ — CID 11938525
[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-(1,3-benzothiazol-2-ylmethyl)-methylazanium (PubChem CID 11938525) has the molecular formula C18H22N3O2S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-(1,3-benzothiazol-2-ylmethyl)-methylazanium.
| Compound Name | [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-(1,3-benzothiazol-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 11938525 |
| Molecular Formula | C18H22N3O2S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]methyl-(1,3-benzothiazol-2-ylmethyl)-methylazanium |
| SMILES | C[NH+](Cc1nc2ccccc2s1)CN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C18H21N3O2S/c1-20(10-16-19-14-8-4-5-9-15(14)24-16)11-21-17(22)12-6-2-3-7-13(12)18(21)23/h4-5,8-9,12-13H,2-3,6-7,10-11H2,1H3/p+1/t12-,13-/m0/s1 |
| InChIKey | QIYXGOKQOAHTCJ-STQMWFEESA-O |
| XLogP | 1.44 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|