C15H17N4O3S+ — CID 9282462
1,3-benzothiazol-2-ylmethyl-[(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-methylazanium (PubChem CID 9282462) has the molecular formula C15H17N4O3S+ and a molecular weight of 333.39 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl-[(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-methylazanium.
| Compound Name | 1,3-benzothiazol-2-ylmethyl-[(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9282462 |
| Molecular Formula | C15H17N4O3S+ |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl-[(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-methylazanium |
| SMILES | CCN1C(=O)C(=O)N(C[NH+](C)Cc2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C15H16N4O3S/c1-3-18-13(20)14(21)19(15(18)22)9-17(2)8-12-16-10-6-4-5-7-11(10)23-12/h4-7H,3,8-9H2,1-2H3/p+1 |
| InChIKey | WNTCLVOIKNPYGI-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|