C20H22N2O4S — CID 78822432
2-(1,3-benzothiazol-2-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 78822432) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 78822432 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)ethyl 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CC(C(=O)OCCc1nc2ccccc2s1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C20H22N2O4S/c1-12(22-18(23)13-6-2-3-7-14(13)19(22)24)20(25)26-11-10-17-21-15-8-4-5-9-16(15)27-17/h4-5,8-9,12-14H,2-3,6-7,10-11H2,1H3 |
| InChIKey | SOSCDBXVNBOVDN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|