C21H22BrNO5S — CID 10367865
[(1S,4S,6R,7S)-7-bromo-2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate (PubChem CID 10367865) has the molecular formula C21H22BrNO5S and a molecular weight of 480.38 g/mol. Its IUPAC name is [(1S,4S,6R,7S)-7-bromo-2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,4S,6R,7S)-7-bromo-2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10367865 |
| Molecular Formula | C21H22BrNO5S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | [(1S,4S,6R,7S)-7-bromo-2-[(4-methoxyphenyl)methyl]-3-oxo-2-azabicyclo[2.2.1]heptan-6-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CN2C(=O)[C@@H]3C[C@@H](OS(=O)(=O)c4ccc(C)cc4)[C@H]2[C@H]3Br)cc1 |
| InChI | InChI=1S/C21H22BrNO5S/c1-13-3-9-16(10-4-13)29(25,26)28-18-11-17-19(22)20(18)23(21(17)24)12-14-5-7-15(27-2)8-6-14/h3-10,17-20H,11-12H2,1-2H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | TZJIMTHXJZDQCP-ZRNYENFQSA-N |
| XLogP | 3.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|