C21H24O5S — CID 11825268
[(1R,4S)-4-[(4-methoxyphenyl)methoxymethyl]cyclobut-2-en-1-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11825268) has the molecular formula C21H24O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is [(1R,4S)-4-[(4-methoxyphenyl)methoxymethyl]cyclobut-2-en-1-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,4S)-4-[(4-methoxyphenyl)methoxymethyl]cyclobut-2-en-1-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11825268 |
| Molecular Formula | C21H24O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(1R,4S)-4-[(4-methoxyphenyl)methoxymethyl]cyclobut-2-en-1-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc(COC[C@H]2C=C[C@H]2COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H24O5S/c1-16-3-11-21(12-4-16)27(22,23)26-15-19-8-7-18(19)14-25-13-17-5-9-20(24-2)10-6-17/h3-12,18-19H,13-15H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | IPJZEDNLFVGQEJ-MOPGFXCFSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|