About [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate
[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11234300) has the molecular formula C19H22O6S
and a molecular weight of 378.45 g/mol. Its IUPAC name is [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 11234300 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc([C@@H]2OCC[C@H](COS(=O)(=O)c3ccc(C)cc3)O2)cc1 |
| InChI | InChI=1S/C19H22O6S/c1-14-3-9-18(10-4-14)26(20,21)24-13-17-11-12-23-19(25-17)15-5-7-16(22-2)8-6-15/h3-10,17,19H,11-13H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | XSKCUSGERFTEHW-IEBWSBKVSA-N |
| XLogP | 3.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate (CID 11234300) is [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate is COc1ccc([C@@H]2OCC[C@H](COS(=O)(=O)c3ccc(C)cc3)O2)cc1.
What is the InChIKey of [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is XSKCUSGERFTEHW-IEBWSBKVSA-N. The full InChI is InChI=1S/C19H22O6S/c1-14-3-9-18(10-4-14)26(20,21)24-13-17-11-12-23-19(25-17)15-5-7-16(22-2)8-6-15/h3-10,17,19H,11-13H2,1-2H3/t17-,19-/m1/s1.
What are the key properties of [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate?
[(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 378.45 g/mol, XLogP of 3.21, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4R)-2-(4-methoxyphenyl)-1,3-dioxan-4-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 11234300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).