C21H24O6S — CID 24808667
(4R)-2-(4-methoxyphenyl)-4-methyl-4-[(2R,3R)-3-[(4-methylphenyl)sulfonylmethyl]oxiran-2-yl]-1,3-dioxolane (PubChem CID 24808667) has the molecular formula C21H24O6S and a molecular weight of 404.48 g/mol. Its IUPAC name is (4R)-2-(4-methoxyphenyl)-4-methyl-4-[(2R,3R)-3-[(4-methylphenyl)sulfonylmethyl]oxiran-2-yl]-1,3-dioxolane.
| Compound Name | (4R)-2-(4-methoxyphenyl)-4-methyl-4-[(2R,3R)-3-[(4-methylphenyl)sulfonylmethyl]oxiran-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 24808667 |
| Molecular Formula | C21H24O6S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (4R)-2-(4-methoxyphenyl)-4-methyl-4-[(2R,3R)-3-[(4-methylphenyl)sulfonylmethyl]oxiran-2-yl]-1,3-dioxolane |
| SMILES | COc1ccc(C2OC[C@](C)([C@@H]3O[C@H]3CS(=O)(=O)c3ccc(C)cc3)O2)cc1 |
| InChI | InChI=1S/C21H24O6S/c1-14-4-10-17(11-5-14)28(22,23)12-18-19(26-18)21(2)13-25-20(27-21)15-6-8-16(24-3)9-7-15/h4-11,18-20H,12-13H2,1-3H3/t18-,19+,20?,21+/m0/s1 |
| InChIKey | SUVIFITUNDRASD-ILRWHQKPSA-N |
| XLogP | 3.05 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|