C13H17NaO6S — CID 23683539
sodium [5-methyl-2-(4-methylphenyl)-1,3-dioxan-5-yl]methyl sulfate (PubChem CID 23683539) has the molecular formula C13H17NaO6S and a molecular weight of 324.33 g/mol. Its IUPAC name is sodium [5-methyl-2-(4-methylphenyl)-1,3-dioxan-5-yl]methyl sulfate.
| Compound Name | sodium [5-methyl-2-(4-methylphenyl)-1,3-dioxan-5-yl]methyl sulfate |
|---|---|
| PubChem CID | 23683539 |
| Molecular Formula | C13H17NaO6S |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | sodium [5-methyl-2-(4-methylphenyl)-1,3-dioxan-5-yl]methyl sulfate |
| SMILES | Cc1ccc(C2OCC(C)(COS(=O)(=O)[O-])CO2)cc1.[Na+] |
| InChI | InChI=1S/C13H18O6S.Na/c1-10-3-5-11(6-4-10)12-17-7-13(2,8-18-12)9-19-20(14,15)16;/h3-6,12H,7-9H2,1-2H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | VBCQOBLTYVTOPZ-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|