C18H20O4 — CID 19989572
2-[4-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-dioxolane (PubChem CID 19989572) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[4-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-dioxolane.
| Compound Name | 2-[4-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 19989572 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-[4-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-dioxolane |
| SMILES | Cc1ccc(OCCOc2ccc(C3OCCO3)cc2)cc1 |
| InChI | InChI=1S/C18H20O4/c1-14-2-6-16(7-3-14)19-10-11-20-17-8-4-15(5-9-17)18-21-12-13-22-18/h2-9,18H,10-13H2,1H3 |
| InChIKey | XTFIUOLAGIPFQY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|