C21H27NO5S — CID 176925311
[(2S,5R)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 176925311) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is [(2S,5R)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,5R)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 176925311 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(2S,5R)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CN2C[C@@H](COS(=O)(=O)c3ccc(C)cc3)OC[C@H]2C)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-16-4-10-21(11-5-16)28(23,24)27-15-20-13-22(17(2)14-26-20)12-18-6-8-19(25-3)9-7-18/h4-11,17,20H,12-15H2,1-3H3/t17-,20+/m1/s1 |
| InChIKey | JSMCVUQGROHLGU-XLIONFOSSA-N |
| XLogP | 3.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|